5-Aminolevulinic Acid Hydrochloride
| Price | USD1000.00 |
| Packge | 1KG |
- Min. Order:1KG
- Supply Ability:15tons/week
- Time:2021-07-09
Product Details
- Product Name5-Aminolevulinic Acid Hydrochloride
- CAS No.5451-09-2
- EINECS No.226-679-5
- MFC5H10ClNO3
- MW167.59
- InChIKeyZLHFONARZHCSET-UHFFFAOYSA-N
- AppearancepowderWhite to pale yellow
- Melting point ~150 °C (dec.)
- storage temp. -20°C
- Water Solubility Soluble in dimethyl sulfoxide, methanol and water.
Product description
| product Name | 5-Aminolevulinic acid hydrochloride |
|---|---|
| Synonyms | 5-amino-3-oxopentanoic acid, HCl; d-Aminolevulinic Acid, HCl; 5-Aminolevulinic-3-13C Acid HCl; 5-Amino-15N-levulinic Acid HCl; 5-Amino-4-ketovaleric acid hydrochloride; Aminolevulinic Acid Hydrochloride; 5-amino-4-oxopentanoic acid hydrochloride (1:1); 5-Aminolevulinicacid hydrochloride; 5-Aminolevulinic acid HCl; 5-Amino Levulinic,Hydrochloride Acid; 5-Aminolevulinic Acid Hydrochloride Salt |
| Molecular Formula | C5H10ClNO3 |
| Molecular Weight | 167.5908 |
| InChI | InChI=1/C5H9NO3.ClH/c6-3-4(7)1-2-5(8)9;/h1-3,6H2,(H,8,9);1H |
| CAS Registry Number | 5451-09-2 |
| EINECS | 226-679-5 |
| Molecular Structure |  |
| Melting point | 156-158ºC |
| Boiling point | 298.4°C at 760 mmHg |
| Flash point | 134.3°C |
| Water solubility | H2O: 50 mg/mL |
| Vapour Pressur | 0.000303mmHg at 25°C |
Application :
1. Used as plant growth regulator
It can regulate the synthesis of chlorophyll, improve the stability of chlorophyll and light system, To improve photosynthetic efficiency to promote the photosynthesis; Promote plant tissue differentiation and inhibit plant breathing in dark, enlarging stomatal and other basic physiological activity. So it is not only a kind of metabolic intermediate, but it is also involved in regulation process of plant growth, it has the similar physiological activity of plant hormone, so it can be used as plant growth regulator in the agricultural production.
2. Used as herbicide
Herbicide which contains 5-Ala can kill weeds of dicotyledonous plants, while it is harmless for many plant belong to the monocotyledonous plant crops such as corn, wheat, barley, so it is selective herbicide.
3. Used as insecticide
It can cause biochemical metabolism imbalance of housefly, cockroaches and other pests, then make the pest convulsions to death. it is a pollution-free natural substance, has biodegradability, and no drug resistance, it is potential new type green pesticide.
Related products
| Product name | CAS |
| 4-Piperidone monohydrate hydrochloride | 40064-34-4 |
| N-BOC-4-piperidone | 79099-07-3 |
| benzyl 4-oxopiperidine-1-carboxylate | 19099-07-3 |
| 2-bromo-1-phenylpentan-1-one | 49851-31-2 |
| 2-Iodo-1-(4-methylphenyl)-1-propanone | 236117-38-7 |
| 2-iodo-1-phenyl-pentane-1-one | 124878-55-3 |
| ethyl 3-oxo-2-phenylbutanoate | 5413-05-8 |
| N-(2-benzoyl-4-nitrophenyl)-2-bromoacetamide | 2011-70-3 |
| Tetracaine hydrochloride | 136-47-0 |
| tert-Butyl 4-anilinotetrahydro-1(2H)-pyridinecarboxylate | 125541-22-2 |
| 4-Amino-3,5-dichloroacetophenone | 37148-48-4 |
| 4-Amino-3,5-dichlorophenacylbromide | 37148-47-3 |
| 2,5-Dimethoxybenzaldehyde | 93-02-7 |
| tetracaine | 94-24-6 |
| 4-methylpropiophenone | 5337-93-9 |
| Xylazine hydrochloride | 23076-35-9 |
| 1-Phenyl-2-nitropropene | 705-60-2 |
| 2-Bromo-4'-Methylpropiophenone | 1451-82-7 |
| 2-(benzylamino)-2-methylpropan-1-ol | 10250-27-8 |
| benzocaine | 94-09-7 |
| (2-Bromoethyl)benzene | 103-63-9 |
| lidocaine | 137-58-6 |
| lidocaine hydrochloride | 73-78-9 |
| ethyl 4-aminobenzoate,hydrochloride | 23239-88-5 |
| 4-methoxybenzoic acid | 100-09-4 |
| valerophenone | 1009-14-9 |
| N-Benzylisopropylamine | 102-97-6 |
| Methyl 3-(benzo[d][1,3]dioxol-5-yl)-2-methyloxirane-2-carboxylate | 13605-48-6 |
| lead diacetate trihydrate | 6080-56-4 |
| N-methylformamide | 123-39-7 |
| methylamine hydrochloride | 593-51-1 |
| Hydroxychloroquine sulfate | 747-36-4 |
Our Advantage
1. Any inquiries will be replied within 12 hours.
2. Dedication to quality, supply & service.
3. Strictly on selecting raw materials.
4. OEM/ODM Available.
5. Reasonable & competitive price, fast lead time.
6. Sample is available for your evaluation & Formulation development.
7. Faster delivery:Sample order in stock and 3-7 days for bulk production.
8. We have strong cooperation with DHL, TNT, UPS, FEDEX, EMS. Or you also can choose your own shipping forwarder
Company Profile Introduction
- Since:2019-07-05
- Address: Federation business plaza, qiaoxi district, shijiazhuang city, hebei province